1H-Purine-2,6,8(3H)-trione,9-(4-chlorophenyl)-7,9-dihydro- structure
|
Common Name | 1H-Purine-2,6,8(3H)-trione,9-(4-chlorophenyl)-7,9-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 5444-39-3 | Molecular Weight | 278.65100 | |
| Density | 1.74g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H7ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-(4-chlorophenyl)-3,7-dihydropurine-2,6,8-trione |
|---|
| Density | 1.74g/cm3 |
|---|---|
| Molecular Formula | C11H7ClN4O3 |
| Molecular Weight | 278.65100 |
| Exact Mass | 278.02100 |
| PSA | 103.51000 |
| LogP | 0.34880 |
| Index of Refraction | 1.754 |
| InChIKey | WSURXXZRIHEJDE-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)c2[nH]c(=O)n(-c3ccc(Cl)cc3)c2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |