2-amino-3-(4-methylphenyl)sulfonylpropanoic acid structure
|
Common Name | 2-amino-3-(4-methylphenyl)sulfonylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5445-05-6 | Molecular Weight | 243.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-3-(4-methylphenyl)sulfonylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13NO4S |
|---|---|
| Molecular Weight | 243.28000 |
| Exact Mass | 243.05700 |
| PSA | 105.84000 |
| LogP | 1.96170 |
| InChIKey | RJONYTBYGWELCB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CC(N)C(=O)O)cc1 |
|
~%
2-amino-3-(4-me... CAS#:5445-05-6 |
| Literature: Goodman et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 1251,1956 |
|
~%
2-amino-3-(4-me... CAS#:5445-05-6 |
| Literature: Goodman et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 1251,1956 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-amino-3-(toluene-4-sulfonyl)-propionic acid |
| 2-Amino-3-(toluol-4-sulfonyl)-propionsaeure |