ethyl 2-heptyl-3,3-dimethyl-oxirane-2-carboxylate structure
|
Common Name | ethyl 2-heptyl-3,3-dimethyl-oxirane-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5445-42-1 | Molecular Weight | 242.35400 | |
| Density | 1.232g/cm3 | Boiling Point | 588.2ºC at 760 mmHg | |
| Molecular Formula | C14H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.5ºC | |
| Name | 2,3-epoxy-2-heptyl-3-methyl-butyric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 588.2ºC at 760 mmHg |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.35400 |
| Flash Point | 309.5ºC |
| Exact Mass | 242.18800 |
| PSA | 38.83000 |
| LogP | 3.45760 |
| Index of Refraction | 1.6 |
| InChIKey | HLAIQFADSAKXAX-UHFFFAOYSA-N |
| SMILES | CCCCCCCC1(C(=O)OCC)OC1(C)C |
|
~%
ethyl 2-heptyl-... CAS#:5445-42-1 |
| Literature: Morris; Young Journal of the American Chemical Society, 1955 , vol. 77, p. 6678 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,3-epoxy-2-heptyl-3-methyl-butyric acid ethyl ester |
| 2,3-Epoxy-2-heptyl-3-methyl-buttersaeure-aethylester |
| 2,3-Epoxy-2-heptyl-3-methyl-buttersaeure |
| 2-heptyl-3,3-dimethyl-2-oxiranecarboxylic acid |