4-Quinolinemethanol, a-[[bis(2-hydroxyethyl)amino]methyl]-2-phenyl- structure
|
Common Name | 4-Quinolinemethanol, a-[[bis(2-hydroxyethyl)amino]methyl]-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5445-71-6 | Molecular Weight | 352.42700 | |
| Density | 1.252g/cm3 | Boiling Point | 613ºC at 760mmHg | |
| Molecular Formula | C21H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.5ºC | |
| Name | 2-[bis(2-hydroxyethyl)amino]-1-(2-phenylquinolin-4-yl)ethanol |
|---|
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 613ºC at 760mmHg |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.42700 |
| Flash Point | 324.5ºC |
| Exact Mass | 352.17900 |
| PSA | 76.82000 |
| LogP | 2.22180 |
| Index of Refraction | 1.654 |
| InChIKey | KLZVGZMQXSTUEZ-UHFFFAOYSA-N |
| SMILES | OCCN(CCO)CC(O)c1cc(-c2ccccc2)nc2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |