Hydrazinecarboxamide,2,2-dimethyl-N-2-naphthalenyl
Hydrazinecarboxamide,2,2-dimethyl-N-2-naphthalenyl structure
|
Common Name | Hydrazinecarboxamide,2,2-dimethyl-N-2-naphthalenyl | ||
|---|---|---|---|---|
| CAS Number | 5446-53-7 | Molecular Weight | 229.27800 | |
| Density | 1.211g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-dimethylamino-3-naphthalen-2-yl-urea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.211g/cm3 |
|---|---|
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.27800 |
| Exact Mass | 229.12200 |
| PSA | 44.37000 |
| LogP | 2.90180 |
| Index of Refraction | 1.665 |
| InChIKey | AQLUKTLWXNYXFY-UHFFFAOYSA-N |
| SMILES | CN(C)NC(=O)Nc1ccc2ccccc2c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2928000090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Hydrazinecarbox... CAS#:5446-53-7 |
| Literature: Levy Memorial des Poudres, 1958 , vol. 40, p. 429 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-dimethylamino-3-naphthalen-2-yl-urea? |
| A: CAS number of 1-dimethylamino-3-naphthalen-2-yl-urea is 5446-53-7. |
| Q: What is the English name of 1-dimethylamino-3-naphthalen-2-yl-urea? |
| A: The English name of 1-dimethylamino-3-naphthalen-2-yl-urea is 1-dimethylamino-3-naphthalen-2-yl-urea. |
| Q: What are the upstream materials of 1-dimethylamino-3-naphthalen-2-yl-urea? |
| A: Related upstream materials(CAS) of 1-dimethylamino-3-naphthalen-2-yl-urea: 57-14-7;2243-54-1. |
| Q: What is the LogP of 1-dimethylamino-3-naphthalen-2-yl-urea? |
| A: LogP of 1-dimethylamino-3-naphthalen-2-yl-urea is 2.90180. |
| Q: What is the Chinese name of 5446-53-7? |
| A: Chinese name of 5446-53-7 is 5446-53-7. |
| Q: What is the molecular weight of 1-dimethylamino-3-naphthalen-2-yl-urea? |
| A: Molecular weight of 1-dimethylamino-3-naphthalen-2-yl-urea is 229.27800. |
| Q: What is the SMILES notation of 1-dimethylamino-3-naphthalen-2-yl-urea? |
| A: SMILES notation of 1-dimethylamino-3-naphthalen-2-yl-urea is CN(C)NC(=O)Nc1ccc2ccccc2c1. |
| Q: What is the molecular formula of 1-dimethylamino-3-naphthalen-2-yl-urea? |
| A: Molecular formula of 1-dimethylamino-3-naphthalen-2-yl-urea is C13H15N3O. |
| Q: What is the InChIKey of 1-dimethylamino-3-naphthalen-2-yl-urea? |
| A: InChIKey of 1-dimethylamino-3-naphthalen-2-yl-urea is AQLUKTLWXNYXFY-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1-dimethylamino-3-naphthalen-2-yl-urea? |
| A: Polar surface area (PSA) of 1-dimethylamino-3-naphthalen-2-yl-urea is 44.37000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |