Hydrazinecarboxamide,2,2-dimethyl-N-2-naphthalenyl structure
|
Common Name | Hydrazinecarboxamide,2,2-dimethyl-N-2-naphthalenyl | ||
|---|---|---|---|---|
| CAS Number | 5446-53-7 | Molecular Weight | 229.27800 | |
| Density | 1.211g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-dimethylamino-3-naphthalen-2-yl-urea |
|---|
| Density | 1.211g/cm3 |
|---|---|
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.27800 |
| Exact Mass | 229.12200 |
| PSA | 44.37000 |
| LogP | 2.90180 |
| Index of Refraction | 1.665 |
| InChIKey | AQLUKTLWXNYXFY-UHFFFAOYSA-N |
| SMILES | CN(C)NC(=O)Nc1ccc2ccccc2c1 |
| HS Code | 2928000090 |
|---|
|
~%
Hydrazinecarbox... CAS#:5446-53-7 |
| Literature: Levy Memorial des Poudres, 1958 , vol. 40, p. 429 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |