(2E)-2-hydroxyimino-3,4-diphenyl-cyclopent-3-en-1-one structure
|
Common Name | (2E)-2-hydroxyimino-3,4-diphenyl-cyclopent-3-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 5446-65-1 | Molecular Weight | 263.29100 | |
| Density | 1.197g/cm3 | Boiling Point | 466.169ºC at 760 mmHg | |
| Molecular Formula | C17H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.731ºC | |
| Name | 2-hydroxyimino-3,4-diphenylcyclopent-3-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 466.169ºC at 760 mmHg |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.29100 |
| Flash Point | 235.731ºC |
| Exact Mass | 263.09500 |
| PSA | 49.66000 |
| LogP | 3.40040 |
| Index of Refraction | 1.627 |
| InChIKey | PMDSLNUJQBMKTR-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccc2)=C(c2ccccc2)C1=NO |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3,4-diphenyl-cyclopent-3-ene-1,2-dione-2-oxime |
| 3,4-Diphenyl-cyclopent-3-en-1,2-dion-2-oxim |
| (2E)-2-HYDROXYIMINO-3,4-DIPHENYL-CYCLOPENT-3-EN-1-ONE |