5,6,11,12-Naphthacenetetrone,5a,11a-dihydro structure
|
Common Name | 5,6,11,12-Naphthacenetetrone,5a,11a-dihydro | ||
|---|---|---|---|---|
| CAS Number | 5446-67-3 | Molecular Weight | 290.27000 | |
| Density | 1.422g/cm3 | Boiling Point | 548.1ºC at 760 mmHg | |
| Molecular Formula | C18H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242ºC | |
| Name | 5a,11a-dihydrotetracene-5,6,11,12-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 548.1ºC at 760 mmHg |
| Molecular Formula | C18H10O4 |
| Molecular Weight | 290.27000 |
| Flash Point | 242ºC |
| Exact Mass | 290.05800 |
| PSA | 68.28000 |
| LogP | 2.37720 |
| Index of Refraction | 1.661 |
| InChIKey | QLQNVANYCBGLKC-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)C2C(=O)c3ccccc3C(=O)C12 |
| HS Code | 2914190090 |
|---|
|
~%
5,6,11,12-Napht... CAS#:5446-67-3 |
| Literature: Knorr; Scheidt Chemische Berichte, 1894 , vol. 27, p. 1168 Full Text Show Details Knorr; Schmidt Justus Liebigs Annalen der Chemie, 1896 , vol. 293, p. 108 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914190090 |
|---|---|
| Summary | 2914190090 other acyclic ketones without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 5a,11a-dihydro-naphthacene-5,6,11,12-tetraone |
| 9.10.11.12-Tetraoxo-9.10.11.12.15.16-hexahydro-naphthacen |
| 5a,11a-Dihydro-naphthacen-5,6,11,12-tetraon |
| 5,6,11,12-naphthacenetetrone,5a,11a-dihydro |
| Naphthacendichinon-dihydrid |
| 5,6,11,12-Tetraoxo-5,5a,6,11,11a,12-hexahydro-naphthacen |
| 15.16-Dihydro-naphthacendichinon-(9.10,11.12) |
| 9.10.11.12-Tetraoxo-naphthacen-hexahydrid-(9.10.11.12.15.16) |