(2-cyclohexyl-2-phenylacetyl) 2-cyclohexyl-2-phenylacetate
Modify Date: 2025-11-25 11:29:07
(2-cyclohexyl-2-phenylacetyl) 2-cyclohexyl-2-phenylacetate structure
|
Common Name | (2-cyclohexyl-2-phenylacetyl) 2-cyclohexyl-2-phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 5446-75-3 | Molecular Weight | 418.56800 | |
| Density | 1.112g/cm3 | Boiling Point | 541.7ºC at 760mmHg | |
| Molecular Formula | C28H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.9ºC | |
| Name | (2-cyclohexyl-2-phenylacetyl) 2-cyclohexyl-2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.112g/cm3 |
|---|---|
| Boiling Point | 541.7ºC at 760mmHg |
| Molecular Formula | C28H34O3 |
| Molecular Weight | 418.56800 |
| Flash Point | 254.9ºC |
| Exact Mass | 418.25100 |
| PSA | 43.37000 |
| LogP | 6.78440 |
| Index of Refraction | 1.566 |
| InChIKey | YYVKJPVHYXQDTL-UHFFFAOYSA-N |
| SMILES | O=C(OC(=O)C(c1ccccc1)C1CCCCC1)C(c1ccccc1)C1CCCCC1 |
| HS Code | 2916399090 |
|---|
|
~77%
(2-cyclohexyl-2... CAS#:5446-75-3 |
| Literature: Voisin, Daniel; Gastambide, Bernard Tetrahedron Letters, 1985 , vol. 26, # 12 p. 1503 - 1504 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
Total 1, Current Page 1 of 1
1
| Cyclohexyl-phenyl-essigsaeure-anhydrid |
| cyclohexyl-phenyl-acetic acid-anhydride |