Tris(1-methylbutyl) tetrathiophosphate
Modify Date: 2025-09-13 11:35:46
Tris(1-methylbutyl) tetrathiophosphate structure
|
Common Name | Tris(1-methylbutyl) tetrathiophosphate | ||
|---|---|---|---|---|
| CAS Number | 5446-91-3 | Molecular Weight | 372.65600 | |
| Density | 1.061g/cm3 | Boiling Point | 444ºC at 760 mmHg | |
| Molecular Formula | C15H33PS4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.3ºC | |
| Name | tris(pentan-2-ylsulfanyl)-sulfanylidene-λ5-phosphane |
|---|
| Density | 1.061g/cm3 |
|---|---|
| Boiling Point | 444ºC at 760 mmHg |
| Molecular Formula | C15H33PS4 |
| Molecular Weight | 372.65600 |
| Flash Point | 222.3ºC |
| Exact Mass | 372.12000 |
| PSA | 117.80000 |
| LogP | 8.62690 |
| Index of Refraction | 1.536 |
| InChIKey | VLAKSLQJJNCUNF-UHFFFAOYSA-N |
| SMILES | CCCC(C)SP(=S)(SC(C)CCC)SC(C)CCC |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 3, Current Page 1 of 1
1