(R)-4-(2-(4,4-Dimethyl-1-cyclopenten-1-yl)propyl)-3-furancarboxaldehyd e structure
|
Common Name | (R)-4-(2-(4,4-Dimethyl-1-cyclopenten-1-yl)propyl)-3-furancarboxaldehyd e | ||
|---|---|---|---|---|
| CAS Number | 54462-53-2 | Molecular Weight | 232.31800 | |
| Density | 1.029g/cm3 | Boiling Point | 317.7ºC at 760 mmHg | |
| Molecular Formula | C15H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.5ºC | |
| Name | 4-[(2R)-2-(4,4-dimethylcyclopenten-1-yl)propyl]furan-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.029g/cm3 |
|---|---|
| Boiling Point | 317.7ºC at 760 mmHg |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.31800 |
| Flash Point | 103.5ºC |
| Exact Mass | 232.14600 |
| PSA | 30.21000 |
| LogP | 4.01710 |
| Index of Refraction | 1.526 |
| InChIKey | VTVXUNQJWFOXFX-LLVKDONJSA-N |
| SMILES | CC(Cc1cocc1C=O)C1=CCC(C)(C)C1 |
| HS Code | 2932190090 |
|---|
|
~%
(R)-4-(2-(4,4-D... CAS#:54462-53-2 |
| Literature: Sterner, Olov; Bergman, Rolf; Franzen, Claes; Wickberg, Boerje Tetrahedron Letters, 1985 , vol. 26, # 26 p. 3163 - 3166 |
|
~%
(R)-4-(2-(4,4-D... CAS#:54462-53-2 |
| Literature: Sterner, Olov; Bergman, Rolf; Franzen, Claes; Wickberg, Boerje Tetrahedron Letters, 1985 , vol. 26, # 26 p. 3163 - 3166 |
|
~%
(R)-4-(2-(4,4-D... CAS#:54462-53-2 |
| Literature: Sterner, Olov; Bergman, Rolf; Franzen, Claes; Wickberg, Boerje Tetrahedron Letters, 1985 , vol. 26, # 26 p. 3163 - 3166 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| furan lactaral |
| Lactaral |