diethyl 2-(1,3-dioxoinden-2-yl)-2-hydroxy-propanedioate structure
|
Common Name | diethyl 2-(1,3-dioxoinden-2-yl)-2-hydroxy-propanedioate | ||
|---|---|---|---|---|
| CAS Number | 54469-40-8 | Molecular Weight | 320.29400 | |
| Density | 1.382g/cm3 | Boiling Point | 485ºC at 760 mmHg | |
| Molecular Formula | C16H16O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.5ºC | |
| Name | diethyl 2-(1,3-dioxoinden-2-yl)-2-hydroxypropanedioate |
|---|
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 485ºC at 760 mmHg |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.29400 |
| Flash Point | 177.5ºC |
| Exact Mass | 320.09000 |
| PSA | 106.97000 |
| LogP | 0.53910 |
| Index of Refraction | 1.568 |
| InChIKey | FQOQWPLSGADWGG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(O)(C(=O)OCC)C1C(=O)c2ccccc2C1=O |
|
~83%
diethyl 2-(1,3-... CAS#:54469-40-8 |
| Literature: Karmakar, Sulakshana; Chakrabarty, Manas Journal of the Indian Chemical Society, 2008 , vol. 85, # 2 p. 224 - 227 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |