2,3-Dihydro-1H-cyclopenta(b)quinoline-9-carboxylic acid structure
|
Common Name | 2,3-Dihydro-1H-cyclopenta(b)quinoline-9-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 5447-47-2 | Molecular Weight | 213.23200 | |
| Density | 1.346g/cm3 | Boiling Point | 405.7ºC at 760 mmHg | |
| Molecular Formula | C13H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.1ºC | |
| Name | 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.346g/cm3 |
|---|---|
| Boiling Point | 405.7ºC at 760 mmHg |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.23200 |
| Flash Point | 199.1ºC |
| Exact Mass | 213.07900 |
| PSA | 50.19000 |
| LogP | 2.42170 |
| Index of Refraction | 1.701 |
| InChIKey | YHLOYZLGFGTCEB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c2c(nc3ccccc13)CCC2 |
| HS Code | 2933990090 |
|---|
|
~40%
2,3-Dihydro-1H-... CAS#:5447-47-2 |
| Literature: Lv, Qinghua; Fang, Lizhen; Wang, Pengfei; Lu, Chenjuan; Yan, Fulin Monatshefte fur Chemie, 2013 , vol. 144, # 3 p. 391 - 394 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-Trimethylen-cinchoninsaeure |
| 2,3-DIAMINOTOLUENE,DARK RED SOLID |