Ethanone,2,2'-(1,4-piperazinediyl)bis[1-(4-chlorophenyl)-
Modify Date: 2025-08-29 17:43:25
Ethanone,2,2'-(1,4-piperazinediyl)bis[1-(4-chlorophenyl)- structure
|
Common Name | Ethanone,2,2'-(1,4-piperazinediyl)bis[1-(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5447-51-8 | Molecular Weight | 391.29100 | |
| Density | 1.276g/cm3 | Boiling Point | 540.6ºC at 760mmHg | |
| Molecular Formula | C20H20Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.8ºC | |
| Name | 1-(4-chlorophenyl)-2-[4-[2-(4-chlorophenyl)-2-oxoethyl]piperazin-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 540.6ºC at 760mmHg |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.29100 |
| Flash Point | 280.8ºC |
| Exact Mass | 390.09000 |
| PSA | 40.62000 |
| LogP | 3.55240 |
| Index of Refraction | 1.593 |
| InChIKey | CDKYFIXVETUUNB-UHFFFAOYSA-N |
| SMILES | O=C(CN1CCN(CC(=O)c2ccc(Cl)cc2)CC1)c1ccc(Cl)cc1 |
| HS Code | 2933599090 |
|---|
|
~%
Ethanone,2,2'-(... CAS#:5447-51-8 |
| Literature: Lutz; Shearer Journal of Organic Chemistry, 1947 , vol. 12, p. 771,773 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms3089h06 |