Benzenepropanoic acid,4-methoxy-a-phenyl-, methyl ester
Modify Date: 2026-07-08 20:17:12
Benzenepropanoic acid,4-methoxy-a-phenyl-, methyl ester structure
|
Common Name | Benzenepropanoic acid,4-methoxy-a-phenyl-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 5448-41-9 | Molecular Weight | 270.32300 | |
| Density | 1.106g/cm3 | Boiling Point | 363.4ºC at 760mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.8ºC | |
| Name | methyl 3-(4-methoxyphenyl)-2-phenylpropanoate |
|---|
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 363.4ºC at 760mmHg |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32300 |
| Flash Point | 151.8ºC |
| Exact Mass | 270.12600 |
| PSA | 35.53000 |
| LogP | 3.19450 |
| Index of Refraction | 1.551 |
| InChIKey | QUSZWDXQDDGIMZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cc1ccc(OC)cc1)c1ccccc1 |
| HS Code | 2918990090 |
|---|
|
~%
Benzenepropanoi... CAS#:5448-41-9 |
| Literature: Faltis; Wrann; Kuehas Justus Liebigs Annalen der Chemie, 1932 , vol. 497, p. 73,78 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1