4-Amino-N-(1,3-benzodioxol-5-ylmethylene)benzenesulfonohydrazide structure
|
Common Name | 4-Amino-N-(1,3-benzodioxol-5-ylmethylene)benzenesulfonohydrazide | ||
|---|---|---|---|---|
| CAS Number | 5448-75-9 | Molecular Weight | 319.33600 | |
| Density | 1.507g/cm3 | Boiling Point | 539.357ºC at 760 mmHg | |
| Molecular Formula | C14H13N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.993ºC | |
| Name | 4-amino-N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.507g/cm3 |
|---|---|
| Boiling Point | 539.357ºC at 760 mmHg |
| Molecular Formula | C14H13N3O4S |
| Molecular Weight | 319.33600 |
| Flash Point | 279.993ºC |
| Exact Mass | 319.06300 |
| PSA | 111.39000 |
| LogP | 3.36280 |
| Index of Refraction | 1.679 |
| InChIKey | SLPFHVAXJGXOMS-LZYBPNLTSA-N |
| SMILES | Nc1ccc(S(=O)(=O)NN=Cc2ccc3c(c2)OCO3)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
4-Amino-N-(1,3-... CAS#:5448-75-9 |
| Literature: Zimmer et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 1667,1668, 1673 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: Inhibition of ribonuclease H activity of HIV1 reverse transcriptase using as poly(dC)...
Source: ChEMBL
Target: Reverse transcriptase/RNaseH
External Id: CHEMBL1959154
|
| piperonal-sulfanilylhydrazone |