acetyloxy-(2-amino-5-nitrophenyl)mercury structure
|
Common Name | acetyloxy-(2-amino-5-nitrophenyl)mercury | ||
|---|---|---|---|---|
| CAS Number | 54481-45-7 | Molecular Weight | 396.75000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8HgN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetyloxy-(2-amino-5-nitrophenyl)mercury |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8HgN2O4 |
|---|---|
| Molecular Weight | 396.75000 |
| Exact Mass | 398.01900 |
| PSA | 94.90000 |
| InChIKey | ULKGSTLXKBIBSQ-UHFFFAOYSA-M |
| SMILES | CC(=O)O[Hg]c1cc([N+](=O)[O-])ccc1N |
| HS Code | 2931900090 |
|---|
|
~%
acetyloxy-(2-am... CAS#:54481-45-7 |
| Literature: Kharasch, M. S.; Lommen, F. W. M.; Jacobsohn, I. M. Journal of the American Chemical Society, 1922 , vol. 44, p. 793 - 805 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| ANILINE,2-(ACETOXYMERCURI)-4-NITRO |
| Mercury,acetato(2-amino-5-nitrophenyl) |
| 2-Acetoxy-quecksilber(II)--3-nitranilin |
| 2-acetoxymercury(II) 4-nitroaniline |