N-(3,4-dimethylphenyl)-3-methyl-but-2-enamide
Modify Date: 2025-10-04 18:48:55
N-(3,4-dimethylphenyl)-3-methyl-but-2-enamide structure
|
Common Name | N-(3,4-dimethylphenyl)-3-methyl-but-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 5449-05-8 | Molecular Weight | 203.28000 | |
| Density | 1.026g/cm3 | Boiling Point | 364.5ºC at 760 mmHg | |
| Molecular Formula | C13H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219ºC | |
| Name | 1-[[4-[(9,10-dioxoanthracen-1-yl)amino]-6-phenyl-1,3,5-triazin-2-yl]amino]anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.026g/cm3 |
|---|---|
| Boiling Point | 364.5ºC at 760 mmHg |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28000 |
| Flash Point | 219ºC |
| Exact Mass | 203.13100 |
| PSA | 29.10000 |
| LogP | 3.28110 |
| Index of Refraction | 1.559 |
| InChIKey | BQXFAHUDSBTCBA-UHFFFAOYSA-N |
| SMILES | CC(C)=CC(=O)Nc1ccc(C)c(C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2H-Cyclopenta[d]thiazol-2-one,3,4,5,6-tetrahydro-3-methyl |
| 3-methyl-3,4,5,6-tetrahydro-cyclopentathiazol-2-one |
| 3-Methyl-3',4'-crotonoxylidid |