2-Thiophenepropanoicacid, b-hydroxy-b-methyl-a-phenyl- structure
|
Common Name | 2-Thiophenepropanoicacid, b-hydroxy-b-methyl-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5449-23-0 | Molecular Weight | 262.32400 | |
| Density | 1.316g/cm3 | Boiling Point | 402.9ºC at 760mmHg | |
| Molecular Formula | C14H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.5ºC | |
| Name | 3-hydroxy-2-phenylisoindol-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 402.9ºC at 760mmHg |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.32400 |
| Flash Point | 197.5ºC |
| Exact Mass | 262.06600 |
| PSA | 85.77000 |
| LogP | 2.82400 |
| Index of Refraction | 1.627 |
| InChIKey | ZYRCCIZYGMCRSY-UHFFFAOYSA-N |
| SMILES | CC(O)(c1cccs1)C(C(=O)O)c1ccccc1 |
| HS Code | 2934999090 |
|---|
|
~%
2-Thiopheneprop... CAS#:5449-23-0 |
| Literature: Blicke, Cox Journal of the American Chemical Society, 1955 , vol. 77, p. 5401 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-hydroxy-2-phenyl-2,3-dihydro-1H-isoindol-1-one |
| 3-hydroxy-2-phenyl-2,3-dihydro-isoindol-1-one |
| 3-Hydroxy-2-phenyl-3-[2]thienyl-buttersaeure |
| 2,3-dihydro-3-hydroxy-2-phenyl-1H-isoindol-1-one |
| 3-hydroxy-2-phenyl-isoindolin-1-one |
| 3-hydroxy-2-phenyl-3-[2]thienyl-butyric acid |
| 3-Hydroxy-2-phenyl-isoindolin-1-on |