3-cyclohexyl-3-hydroxy-2-phenyl-propanoic acid structure
|
Common Name | 3-cyclohexyl-3-hydroxy-2-phenyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5449-32-1 | Molecular Weight | 248.31700 | |
| Density | 1.17g/cm3 | Boiling Point | 410.7ºC at 760 mmHg | |
| Molecular Formula | C15H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.3ºC | |
| Name | 3-Cyclohexyl-3-hydroxy-2-phenyl-propionsaeure |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 410.7ºC at 760 mmHg |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.31700 |
| Flash Point | 216.3ºC |
| Exact Mass | 248.14100 |
| PSA | 57.53000 |
| LogP | 2.79600 |
| Index of Refraction | 1.565 |
| InChIKey | FELKSHAELBQVRN-UHFFFAOYSA-N |
| SMILES | O=C(O)C(c1ccccc1)C(O)C1CCCCC1 |
| HS Code | 2918199090 |
|---|
|
~83%
3-cyclohexyl-3-... CAS#:5449-32-1 |
| Literature: Black, T.Howard; DuBay III, William J. Tetrahedron Letters, 1987 , vol. 28, # 41 p. 4787 - 4788 |
|
~%
3-cyclohexyl-3-... CAS#:5449-32-1 |
| Literature: Blicke; Zinnes Journal of the American Chemical Society, 1955 , vol. 77, p. 6247 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-Cyclohexyl-3-hydroxy-2-phenyl-buttersaeure |
| 3-cyclohexyl-3-hydroxy-2-phenyl-butyric acid |
| 3-cyclohexyl-3-hydroxy-2-phenyl-propionic acid |