Benzeneacetic acid, a-[(phenylamino)carbonyl]-, methylester structure
|
Common Name | Benzeneacetic acid, a-[(phenylamino)carbonyl]-, methylester | ||
|---|---|---|---|---|
| CAS Number | 5449-36-5 | Molecular Weight | 269.29500 | |
| Density | 1.221g/cm3 | Boiling Point | 473ºC at 760mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.8ºC | |
| Name | methyl 3-anilino-3-oxo-2-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 473ºC at 760mmHg |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29500 |
| Flash Point | 239.8ºC |
| Exact Mass | 269.10500 |
| PSA | 55.40000 |
| LogP | 2.65490 |
| Index of Refraction | 1.606 |
| InChIKey | NTTMAHPBAZRDCC-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(=O)Nc1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,N-diphenyl-malonamic acid methyl ester |
| 2,N-Diphenyl-malonamidsaeure-methylester |
| Phenylmalonsaeure-methylester-anilid |