3α,14β-Dihydroxy-5β,14β-carda-20(22)-enolide structure
|
Common Name | 3α,14β-Dihydroxy-5β,14β-carda-20(22)-enolide | ||
|---|---|---|---|---|
| CAS Number | 545-52-8 | Molecular Weight | 374.51400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3α,14β-Dihydroxy-5β,14β-carda-20(22)-enolide3-epi-Digitoxigenin is a triterpene isolated from the leaves and stems of Plumeria frangipani. |
| Name | 3-epi-digitoxigenin |
|---|---|
| Synonym | More Synonyms |
| Description | 3-epi-Digitoxigenin is a triterpene isolated from the leaves and stems of Plumeria frangipani. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H34O4 |
|---|---|
| Molecular Weight | 374.51400 |
| Exact Mass | 374.24600 |
| PSA | 66.76000 |
| LogP | 3.60430 |
| InChIKey | XZTUSOXSLKTKJQ-CTZIAKJASA-N |
| SMILES | CC12CCC(O)CC1CCC1C2CCC2(C)C(C3=CC(=O)OC3)CCC12O |
| 3α,14β-dihydroxy-5β-card-20(22)-enolide |
| 4-((3R,5R,8R,9S,10S,13R,14S,17R)-3,14-Dihydroxy-10,13-dimethyl-hexadecahydro-cyclopenta[a]phenanthren-17-yl)-5H-furan-2-one |
| 3α,14-dihydroxy-5β,14β-card-20(22)-enolide |
| 3-epidigitoxigenin |
| 3-Epi-digitoxigenin |