Delcosine
Delcosine structure
|
Common Name | Delcosine | ||
|---|---|---|---|---|
| CAS Number | 545-56-2 | Molecular Weight | 453.56900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H39NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Delcosine (CAS number 545-56-2), molecular formula C24H39NO7, molecular weight 453.56900, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Delcosine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H39NO7 |
|---|---|
| Molecular Weight | 453.56900 |
| Exact Mass | 453.27300 |
| PSA | 111.85000 |
| InChIKey | BMZNJVXOLCBDPZ-MMEYHWMQSA-N |
| SMILES | CCN1CC2(COC)CCC(O)C34C5CC6C(OC)CC(O)(C5C6O)C(O)(C(OC)C23)C14 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:509-18-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Delcosine? |
| A: SMILES notation of Delcosine is CCN1CC2(COC)CCC(O)C34C5CC6C(OC)CC(O)(C5C6O)C(O)(C(OC)C23)C14. |
| Q: What is the molecular weight of Delcosine? |
| A: Molecular weight of Delcosine is 453.56900. |
| Q: What is the English name of Delcosine? |
| A: The English name of Delcosine is Delcosine. |
| Q: What is the InChIKey of Delcosine? |
| A: InChIKey of Delcosine is BMZNJVXOLCBDPZ-MMEYHWMQSA-N. |
| Q: What is the Chinese name of 545-56-2? |
| A: Chinese name of 545-56-2 is 545-56-2. |
| Q: What is the molecular formula of Delcosine? |
| A: Molecular formula of Delcosine is C24H39NO7. |
| Q: What is the CAS number of Delcosine? |
| A: CAS number of Delcosine is 545-56-2. |
| Q: What is the polar surface area (PSA) of Delcosine? |
| A: Polar surface area (PSA) of Delcosine is 111.85000. |
| Q: What are the downstream products of Delcosine? |
| A: Related downstream products(CAS) of Delcosine: 509-18-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |