(6-aminonaphthalen-2-yl)arsonic acid structure
|
Common Name | (6-aminonaphthalen-2-yl)arsonic acid | ||
|---|---|---|---|---|
| CAS Number | 5450-69-1 | Molecular Weight | 267.11300 | |
| Density | N/A | Boiling Point | 617.8ºC at 760 mmHg | |
| Molecular Formula | C10H10AsNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.4ºC | |
| Name | (6-aminonaphthalen-2-yl)arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 617.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H10AsNO3 |
| Molecular Weight | 267.11300 |
| Flash Point | 327.4ºC |
| Exact Mass | 266.98800 |
| PSA | 83.55000 |
| LogP | 0.56420 |
| InChIKey | JBCHFIJBSDRMPP-UHFFFAOYSA-N |
| SMILES | Nc1ccc2cc([As](=O)(O)O)ccc2c1 |
|
~%
(6-aminonaphtha... CAS#:5450-69-1 |
| Literature: Sweet; Hamilton Journal of the American Chemical Society, 1934 , vol. 56, p. 2408 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (6-Amino-[2]naphthyl)-arsonsaeure |
| (6-amino-[2]naphthyl)-arsonic acid |