Thymol isobutyrate structure
|
Common Name | Thymol isobutyrate | ||
|---|---|---|---|---|
| CAS Number | 5451-67-2 | Molecular Weight | 220.30700 | |
| Density | 0.971g/cm3 | Boiling Point | 277.2ºC at 760mmHg | |
| Molecular Formula | C14H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102.3ºC | |
| Name | ttcep |
|---|---|
| Synonym | More Synonyms |
| Density | 0.971g/cm3 |
|---|---|
| Boiling Point | 277.2ºC at 760mmHg |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.30700 |
| Flash Point | 102.3ºC |
| Exact Mass | 220.14600 |
| PSA | 26.30000 |
| LogP | 3.67980 |
| Index of Refraction | 1.492 |
| InChIKey | HTPVUEJWIFHSCK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)C)c(OC(=O)C(C)C)c1 |
|
~76%
Thymol isobutyrate CAS#:5451-67-2 |
| Literature: Mathela, Chandra S.; Singh, Krishna K.; Gupta, Vivek K. Acta Poloniae Pharmaceutica - Drug Research, 2010 , vol. 67, # 4 p. 375 - 380 |
|
~85%
Thymol isobutyrate CAS#:5451-67-2 |
| Literature: Mathela; Tiwari; Padalia; Chanotiya Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2008 , vol. 47, # 8 p. 1249 - 1253 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-isopropyl-5-methylphenyl isobutyrate |
| thymol isobutyrate |
| thymol isobutylate |
| Isobuttersaeure-thymylester |
| thymyl isobutyrate |