(5-methyl-2-propan-2-yl-phenyl) butanoate structure
|
Common Name | (5-methyl-2-propan-2-yl-phenyl) butanoate | ||
|---|---|---|---|---|
| CAS Number | 5451-70-7 | Molecular Weight | 220.30700 | |
| Density | 0.973g/cm3 | Boiling Point | 282.3ºC at 760 mmHg | |
| Molecular Formula | C14H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.6ºC | |
| Name | (5-methyl-2-propan-2-ylphenyl) butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.973g/cm3 |
|---|---|
| Boiling Point | 282.3ºC at 760 mmHg |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.30700 |
| Flash Point | 103.6ºC |
| Exact Mass | 220.14600 |
| PSA | 26.30000 |
| LogP | 3.82390 |
| Index of Refraction | 1.493 |
| InChIKey | WRIVMPQKUQTSFV-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Oc1cc(C)ccc1C(C)C |
|
~62%
(5-methyl-2-pro... CAS#:5451-70-7 |
| Literature: Angeles-Lopez, Guadalupe; Perez-Vasquez, Araceli; Hernandez-Luis, Francisco; Deciga-Campos, Myrna; Bye, Robert; Linares, Edelmira; Mata, Rachel Journal of Ethnopharmacology, 2010 , vol. 131, # 2 p. 425 - 432 |
|
~%
(5-methyl-2-pro... CAS#:5451-70-7 |
| Literature: Rosenmund; Schnurr Justus Liebigs Annalen der Chemie, 1928 , vol. 460, p. 89 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Buttersaeure-thymylester |
| 3-Butyryloxy-p-cymol |
| Thymylbutyrat |