N-[4-[2-(4-acetamidophenyl)ethyl]phenyl]acetamide
Modify Date: 2025-09-20 17:12:01
![N-[4-[2-(4-acetamidophenyl)ethyl]phenyl]acetamide Structure](https://image.chemsrc.com/caspic/168/54514-51-1.png)
N-[4-[2-(4-acetamidophenyl)ethyl]phenyl]acetamide structure
|
Common Name | N-[4-[2-(4-acetamidophenyl)ethyl]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 54514-51-1 | Molecular Weight | 296.36400 | |
| Density | 1.189g/cm3 | Boiling Point | 552ºC at 760 mmHg | |
| Molecular Formula | C18H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.1ºC | |
| Name | N-[4-[2-(4-acetamidophenyl)ethyl]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 552ºC at 760 mmHg |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.36400 |
| Flash Point | 204.1ºC |
| Exact Mass | 296.15200 |
| PSA | 58.20000 |
| LogP | 3.53460 |
| Index of Refraction | 1.631 |
| InChIKey | QCRSCUNJXGGUIA-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(CCc2ccc(NC(C)=O)cc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-[4-[2-(4-acet... CAS#:54514-51-1 |
| Literature: Mashraqui, Sabir H.; Kumar, Sukeerthi; Nivalkar, Kishore R. Heterocyclic Communications, 2001 , vol. 7, # 1 p. 73 - 78 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| n,n'-(ethane-1,2-diyldibenzene-4,1-diyl)diacetamide |