N,N-Dimethyl-P-phenylphosphonic dihydrazide structure
|
Common Name | N,N-Dimethyl-P-phenylphosphonic dihydrazide | ||
|---|---|---|---|---|
| CAS Number | 54529-67-8 | Molecular Weight | 214.20500 | |
| Density | 1.26g/cm3 | Boiling Point | 347.3ºC at 760 mmHg | |
| Molecular Formula | C8H15N4OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.9ºC | |
| Name | 1-[[amino(methyl)amino]-phenylphosphoryl]-1-methylhydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 347.3ºC at 760 mmHg |
| Molecular Formula | C8H15N4OP |
| Molecular Weight | 214.20500 |
| Flash Point | 163.9ºC |
| Exact Mass | 214.09800 |
| PSA | 85.40000 |
| LogP | 1.51660 |
| Index of Refraction | 1.596 |
| InChIKey | IICZVZRGBFAEOB-UHFFFAOYSA-N |
| SMILES | CN(N)P(=O)(c1ccccc1)N(C)N |
|
~%
N,N-Dimethyl-P-... CAS#:54529-67-8 |
| Literature: Cates; Lemke Journal of Pharmaceutical Sciences, 1974 , vol. 63, # 11 p. 1736 - 1739 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphodihydrazid |
| N,N'-Dimethyl-P-phenylphosphonic dihydrazide |
| 1,1'-dimethyl-P-phenyl-phosphonic-dihydrazide |