8-Oxa-2,3,5,6-tetraaza-4-phosphadecanoicacid, 7-oxo-4-phenyl-, ethyl ester, 4-oxide (9CI) structure
|
Common Name | 8-Oxa-2,3,5,6-tetraaza-4-phosphadecanoicacid, 7-oxo-4-phenyl-, ethyl ester, 4-oxide (9CI) | ||
|---|---|---|---|---|
| CAS Number | 54529-71-4 | Molecular Weight | 330.27700 | |
| Density | 1.31g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H19N4O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-[[(2-ethoxycarbonylhydrazinyl)-phenylphosphoryl]amino]carbamate |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Molecular Formula | C12H19N4O5P |
| Molecular Weight | 330.27700 |
| Exact Mass | 330.10900 |
| PSA | 127.60000 |
| LogP | 2.57000 |
| Index of Refraction | 1.545 |
| InChIKey | DDJFMVGOFNKFKL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NNP(=O)(NNC(=O)OCC)c1ccccc1 |
|
~%
8-Oxa-2,3,5,6-t... CAS#:54529-71-4 |
| Literature: Cates; Lemke Journal of Pharmaceutical Sciences, 1974 , vol. 63, # 11 p. 1736 - 1739 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |