Acetic acid,2-amino-2-oxo-, 2-[[(diphenoxyphosphinyl)amino]thioxomethyl]hydrazide structure
|
Common Name | Acetic acid,2-amino-2-oxo-, 2-[[(diphenoxyphosphinyl)amino]thioxomethyl]hydrazide | ||
|---|---|---|---|---|
| CAS Number | 54529-76-9 | Molecular Weight | 394.34200 | |
| Density | 1.469g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H15N4O5PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-(diphenoxyphosphorylcarbamothioyl)hydrazinyl]-2-oxoacetamide |
|---|
| Density | 1.469g/cm3 |
|---|---|
| Molecular Formula | C15H15N4O5PS |
| Molecular Weight | 394.34200 |
| Exact Mass | 394.05000 |
| PSA | 173.68000 |
| LogP | 3.10610 |
| Index of Refraction | 1.642 |
| InChIKey | FTHJAMSSBFIWLW-UHFFFAOYSA-N |
| SMILES | NC(=O)C(=O)NNC(=S)NP(=O)(Oc1ccccc1)Oc1ccccc1 |
|
~%
Acetic acid,2-a... CAS#:54529-76-9 |
| Literature: Cates; Lemke Journal of Pharmaceutical Sciences, 1974 , vol. 63, # 11 p. 1736 - 1739 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |