Phosphoramidicacid, 1,3,4-thiadiazol-2-yl-, diphenyl ester (9CI) structure
|
Common Name | Phosphoramidicacid, 1,3,4-thiadiazol-2-yl-, diphenyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 54529-78-1 | Molecular Weight | 333.30200 | |
| Density | 1.453g/cm3 | Boiling Point | 460.5ºC at 760mmHg | |
| Molecular Formula | C14H12N3O3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.3ºC | |
| Name | N-diphenoxyphosphoryl-1,3,4-thiadiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 460.5ºC at 760mmHg |
| Molecular Formula | C14H12N3O3PS |
| Molecular Weight | 333.30200 |
| Flash Point | 232.3ºC |
| Exact Mass | 333.03400 |
| PSA | 111.39000 |
| LogP | 4.28910 |
| Index of Refraction | 1.665 |
| InChIKey | NDTXMFTXEMZGPD-UHFFFAOYSA-N |
| SMILES | O=P(Nc1nncs1)(Oc1ccccc1)Oc1ccccc1 |
|
~%
Phosphoramidica... CAS#:54529-78-1 |
| Literature: Cates; Lemke Journal of Pharmaceutical Sciences, 1974 , vol. 63, # 11 p. 1736 - 1739 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| diphenyl 1,3,4-thiadiazol-2-ylphosphoramidate |