(E)-3-(2-hydroxyphenyl)-1-(2-hydroxy-3,4,6-trimethoxy-phenyl)prop-2-en-1-one structure
|
Common Name | (E)-3-(2-hydroxyphenyl)-1-(2-hydroxy-3,4,6-trimethoxy-phenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 5453-01-0 | Molecular Weight | 330.33200 | |
| Density | 1.276g/cm3 | Boiling Point | 581.9ºC at 760 mmHg | |
| Molecular Formula | C18H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.8ºC | |
| Name | (E)-3-(2-hydroxyphenyl)-1-(2-hydroxy-3,4,6-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 581.9ºC at 760 mmHg |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.33200 |
| Flash Point | 212.8ºC |
| Exact Mass | 330.11000 |
| PSA | 85.22000 |
| LogP | 3.01970 |
| Index of Refraction | 1.62 |
| InChIKey | NOXIUTJZGRBUFK-CMDGGOBGSA-N |
| SMILES | COc1cc(OC)c(C(=O)C=Cc2ccccc2O)c(O)c1OC |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2.2'-Dihydroxy-3.4.6-trimethoxy-benzylidenacetophenon |
| 2,2'-Dihydroxy-3',4',6'-trimethoxy-chalkon |