N-(3-chloro-4-methyl-phenyl)-N-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]propanediamide structure
|
Common Name | N-(3-chloro-4-methyl-phenyl)-N-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]propanediamide | ||
|---|---|---|---|---|
| CAS Number | 5453-02-1 | Molecular Weight | 344.35900 | |
| Density | 1.211g/cm3 | Boiling Point | 558.5ºC at 760 mmHg | |
| Molecular Formula | C19H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.2ºC | |
| Name | (E)-1-(2-hydroxy-3,4,6-trimethoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 558.5ºC at 760 mmHg |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.35900 |
| Flash Point | 200.2ºC |
| Exact Mass | 344.12600 |
| PSA | 74.22000 |
| LogP | 3.32270 |
| Index of Refraction | 1.588 |
| InChIKey | MAOWYEHMWILRMH-JXMROGBWSA-N |
| SMILES | COc1ccc(C=CC(=O)c2c(OC)cc(OC)c(OC)c2O)cc1 |
| HS Code | 2914509090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(2-Hydroxy-3,4,6-trimethoxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one |
| Chalcone,2'-hydroxy-3',4,4',6'-tetramethoxy |
| 2-Hydroxy-3.4.6.4'-tetramethoxy-chalkon |