Butanoic acid,1-methyl-1,4,7-heptanetriyl ester (9CI) structure
|
Common Name | Butanoic acid,1-methyl-1,4,7-heptanetriyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5453-21-4 | Molecular Weight | 372.49600 | |
| Density | 1.007g/cm3 | Boiling Point | 442.5ºC at 760mmHg | |
| Molecular Formula | C20H36O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.5ºC | |
| Name | 4,7-di(butanoyloxy)octyl butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.007g/cm3 |
|---|---|
| Boiling Point | 442.5ºC at 760mmHg |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.49600 |
| Flash Point | 187.5ºC |
| Exact Mass | 372.25100 |
| PSA | 78.90000 |
| LogP | 4.33380 |
| Index of Refraction | 1.452 |
| InChIKey | CBYWYTIHGQZVDT-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OCCCC(CCC(C)OC(=O)CCC)OC(=O)CCC |
| HS Code | 2915900090 |
|---|
|
~%
Butanoic acid,1... CAS#:5453-21-4 |
| Literature: Russell et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 726 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| octane-1,4,7-triyl tributanoate |
| 1,4,7-tris-butyryloxy-octane |