5-methyl-2-(4-methylphenyl)sulfonyl-benzoic acid structure
|
Common Name | 5-methyl-2-(4-methylphenyl)sulfonyl-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 5453-69-0 | Molecular Weight | 290.33400 | |
| Density | 1.302g/cm3 | Boiling Point | 495.9ºC at 760 mmHg | |
| Molecular Formula | C15H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.7ºC | |
| Name | 5-methyl-2-(4-methylphenyl)sulfonylbenzoic acid |
|---|
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 495.9ºC at 760 mmHg |
| Molecular Formula | C15H14O4S |
| Molecular Weight | 290.33400 |
| Flash Point | 253.7ºC |
| Exact Mass | 290.06100 |
| PSA | 79.82000 |
| LogP | 3.91520 |
| Index of Refraction | 1.595 |
| InChIKey | HTGGFNSMHGLGPF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(C)cc2C(=O)O)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |