Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1)
Modify Date: 2026-07-03 09:13:31
Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1) structure
|
Common Name | Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1) | ||
|---|---|---|---|---|
| CAS Number | 54532-18-2 | Molecular Weight | 349.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H11HgNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H11HgNO2S |
|---|---|
| Molecular Weight | 349.81 |
| InChIKey | XZCXTELHLAJJNR-UHFFFAOYSA-M |
| SMILES | NC(CCS)C(=O)[O-].[CH3-].[Hg+2] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1)? |
| A: SMILES notation of Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1) is NC(CCS)C(=O)[O-].[CH3-].[Hg+2]. |
| Q: What is the CAS number of Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1)? |
| A: CAS number of Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1) is 54532-18-2. |
| Q: What is the Chinese name of 54532-18-2? |
| A: Chinese name of 54532-18-2 is 54532-18-2. |
| Q: What is the English name of Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1)? |
| A: The English name of Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1) is Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1). |
| Q: What is the molecular formula of Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1)? |
| A: Molecular formula of Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1) is C5H11HgNO2S. |
| Q: What is the InChIKey of Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1)? |
| A: InChIKey of Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1) is XZCXTELHLAJJNR-UHFFFAOYSA-M. |
| Q: What is the molecular weight of Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1)? |
| A: Molecular weight of Mercury 2-amino-4-sulfanylbutanoate methanide (1/1/1) is 349.81. |