Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate
Modify Date: 2026-06-28 10:29:58
Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate structure
|
Common Name | Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate | ||
|---|---|---|---|---|
| CAS Number | 545357-85-5 | Molecular Weight | 259.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12F3NO2 |
|---|---|
| Molecular Weight | 259.22 |
| InChIKey | HXKMWQLKGOAUFR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=NCc1ccccc1)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate? |
| A: The English name of Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate is Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate. |
| Q: What is the molecular weight of Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate? |
| A: Molecular weight of Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate is 259.22. |
| Q: What is the SMILES notation of Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate? |
| A: SMILES notation of Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate is CCOC(=O)C(=NCc1ccccc1)C(F)(F)F. |
| Q: What is the InChIKey of Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate? |
| A: InChIKey of Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate is HXKMWQLKGOAUFR-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate? |
| A: Molecular formula of Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate is C12H12F3NO2. |
| Q: What is the Chinese name of 545357-85-5? |
| A: Chinese name of 545357-85-5 is 545357-85-5. |
| Q: What is the CAS number of Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate? |
| A: CAS number of Ethyl 2-(benzylimino)-3,3,3-trifluoropropanoate is 545357-85-5. |