cyclohepten-1-yl 2,2,2-trichloroacetate structure
|
Common Name | cyclohepten-1-yl 2,2,2-trichloroacetate | ||
|---|---|---|---|---|
| CAS Number | 545376-57-6 | Molecular Weight | 257.54100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cyclohepten-1-yl 2,2,2-trichloroacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11Cl3O2 |
|---|---|
| Molecular Weight | 257.54100 |
| Exact Mass | 255.98200 |
| PSA | 26.30000 |
| LogP | 3.74780 |
| InChIKey | JMXUVXIUWJGSRT-UHFFFAOYSA-N |
| SMILES | O=C(OC1=CCCCCC1)C(Cl)(Cl)Cl |
|
~%
cyclohepten-1-y... CAS#:545376-57-6 |
| Literature: Momiyama, Norie; Yamamoto, Hisashi Journal of the American Chemical Society, 2003 , vol. 125, # 20 p. 6038 - 6039 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-trichloroacetoxycycloheptene |
| Acetic acid,trichloro-,1-cyclohepten-1-yl ester |