3-Pyrazolidinone,5,5-dimethyl-2-phenyl- structure
|
Common Name | 3-Pyrazolidinone,5,5-dimethyl-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5454-02-4 | Molecular Weight | 190.24200 | |
| Density | 1.087g/cm3 | Boiling Point | 272.4ºC at 760mmHg | |
| Molecular Formula | C11H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.6ºC | |
| Name | 5,5-dimethyl-2-phenylpyrazolidin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 272.4ºC at 760mmHg |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.24200 |
| Flash Point | 118.6ºC |
| Exact Mass | 190.11100 |
| PSA | 32.34000 |
| LogP | 2.10030 |
| Index of Refraction | 1.537 |
| InChIKey | HXIUYEXGEYYABB-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)N(c2ccccc2)N1 |
| HS Code | 2933990090 |
|---|
|
~13%
3-Pyrazolidinon... CAS#:5454-02-4 |
| Literature: Shustov, G. V.; Tavakalyan, N. B.; Kostyanovsky, R. G. Tetrahedron, 1985 , vol. 41, # 3 p. 575 - 584 |
|
~%
3-Pyrazolidinon... CAS#:5454-02-4 |
| Literature: Prentice Justus Liebigs Annalen der Chemie, 1896 , vol. 292, p. 287 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,5-dimethyl-2-phenyl-3-pyrazolidinone |
| 1-Phenyl-3,3-dimethyl-pyrazolidon-5 |
| 3,3-dimethyl-1-phenylpyrazolidin-5-one |
| 5,5-Dimethyl-2-phenyl-pyrazolidin-3-on |
| 5,5-dimethyl-2-phenyl-pyrazolidin-3-one |