Phosphoric acid,6-bromo-1,3-benzodioxol-5-yl diethyl ester structure
|
Common Name | Phosphoric acid,6-bromo-1,3-benzodioxol-5-yl diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5454-27-3 | Molecular Weight | 353.10300 | |
| Density | 1.554g/cm3 | Boiling Point | 369.1ºC at 760 mmHg | |
| Molecular Formula | C11H14BrO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177ºC | |
| Name | (6-bromo-1,3-benzodioxol-5-yl) diethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.554g/cm3 |
|---|---|
| Boiling Point | 369.1ºC at 760 mmHg |
| Molecular Formula | C11H14BrO6P |
| Molecular Weight | 353.10300 |
| Flash Point | 177ºC |
| Exact Mass | 351.97100 |
| PSA | 73.03000 |
| LogP | 3.73770 |
| Index of Refraction | 1.537 |
| InChIKey | ALROGCOCZXGYAZ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)Oc1cc2c(cc1Br)OCO2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-bromo-1,3-benzodioxol-5-yl diethyl phosphate |
| Diaethyl-<6-brom-3,4-methylendioxy-phenyl>-phosphat |