Urea,N-butyl-N'-[4-(phenylsulfonyl)phenyl]- structure
|
Common Name | Urea,N-butyl-N'-[4-(phenylsulfonyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 5454-36-4 | Molecular Weight | 332.41700 | |
| Density | 1.234g/cm3 | Boiling Point | 494ºC at 760 mmHg | |
| Molecular Formula | C17H20N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.6ºC | |
| Name | 1-[4-(benzenesulfonyl)phenyl]-3-butylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 494ºC at 760 mmHg |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.41700 |
| Flash Point | 252.6ºC |
| Exact Mass | 332.11900 |
| PSA | 83.65000 |
| LogP | 4.98570 |
| Index of Refraction | 1.589 |
| InChIKey | OJTIMABLGFCFDT-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)Nc1ccc(S(=O)(=O)c2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
Urea,N-butyl-N'... CAS#:5454-36-4 |
| Literature: Palazzo; Pozzatti Farmaco, Edizione Scientifica, 1959 , vol. 14, p. 358,361 |
|
~%
Urea,N-butyl-N'... CAS#:5454-36-4 |
| Literature: Palazzo; Pozzatti Farmaco, Edizione Scientifica, 1959 , vol. 14, p. 358,361 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-Benzolsulfonyl-phenyl)-N'-butyl-harnstoff |
| 1-butyl-3-[4-(phenylsulfonyl)phenyl]urea |
| N-(4-benzenesulfonyl-phenyl)-N'-butyl-urea |