dibutyl 2-[(4-methylphenyl)sulfonylamino]butanedioate structure
|
Common Name | dibutyl 2-[(4-methylphenyl)sulfonylamino]butanedioate | ||
|---|---|---|---|---|
| CAS Number | 5454-85-3 | Molecular Weight | 399.50200 | |
| Density | 1.157g/cm3 | Boiling Point | 518.9ºC at 760 mmHg | |
| Molecular Formula | C19H29NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.6ºC | |
| Name | dibutyl 2-[(4-methylphenyl)sulfonylamino]butanedioate |
|---|
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 518.9ºC at 760 mmHg |
| Molecular Formula | C19H29NO6S |
| Molecular Weight | 399.50200 |
| Flash Point | 267.6ºC |
| Exact Mass | 399.17200 |
| PSA | 107.15000 |
| LogP | 4.19030 |
| Index of Refraction | 1.509 |
| InChIKey | VDDKBRLGEMPLKQ-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CC(NS(=O)(=O)c1ccc(C)cc1)C(=O)OCCCC |
|
~%
dibutyl 2-[(4-m... CAS#:5454-85-3 |
| Literature: McChesney; Swann Journal of the American Chemical Society, 1937 , vol. 59, p. 1116 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |