3-(5-phenyltetrazol-1-yl)quinoline
Modify Date: 2025-08-25 06:34:01
3-(5-phenyltetrazol-1-yl)quinoline structure
|
Common Name | 3-(5-phenyltetrazol-1-yl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 5454-91-1 | Molecular Weight | 273.29200 | |
| Density | 1.32g/cm3 | Boiling Point | 512.7ºC at 760 mmHg | |
| Molecular Formula | C16H11N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.9ºC | |
| Name | 3-(5-phenyltetrazol-1-yl)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 512.7ºC at 760 mmHg |
| Molecular Formula | C16H11N5 |
| Molecular Weight | 273.29200 |
| Flash Point | 263.9ºC |
| Exact Mass | 273.10100 |
| PSA | 56.49000 |
| LogP | 2.87750 |
| Index of Refraction | 1.731 |
| InChIKey | IFFIRHMTPWKAEO-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2nnnn2-c2cnc3ccccc3c2)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
3-(5-phenyltetr... CAS#:5454-91-1 |
| Literature: Vaughan; Smith Journal of Organic Chemistry, 1958 , vol. 23, p. 1909,1910,1911 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(5-Phenyl-tetrazol-1-yl)-chinolin |
| 3-(5-phenyl-1h-tetrazol-1-yl)quinoline |
| 3-(5-phenyl-tetrazol-1-yl)-quinoline |