4,5-BIS(4-FLUOROPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 4,5-BIS(4-FLUOROPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 54543-38-3 | Molecular Weight | 289.30300 | |
| Density | 1.39g/cm3 | Boiling Point | 377.8ºC at 760 mmHg | |
| Molecular Formula | C14H9F2N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.3ºC | |
| Name | 3,4-bis(4-fluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 377.8ºC at 760 mmHg |
| Molecular Formula | C14H9F2N3S |
| Molecular Weight | 289.30300 |
| Flash Point | 182.3ºC |
| Exact Mass | 289.04900 |
| PSA | 69.51000 |
| LogP | 3.50120 |
| Index of Refraction | 1.66 |
| InChIKey | ATGAVTDHMVBXRF-UHFFFAOYSA-N |
| SMILES | Fc1ccc(-c2n[nH]c(=S)n2-c2ccc(F)cc2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5-bis-(4-fluoro-phenyl)-2,4-dihydro-[1,2,4]triazole-3-thione |
| 4,5-bis(4-fluorophenyl)-4H-1,2,4-triazole-3-thiol |