Methyl 3,4-bis(benzyloxy)benzoate structure
|
Common Name | Methyl 3,4-bis(benzyloxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 54544-05-7 | Molecular Weight | 348.39200 | |
| Density | 1.174±0.06 g/cm3 | Boiling Point | 498.0±35.0 °C | |
| Molecular Formula | C22H20O4 | Melting Point | 57-58 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3,4-bis(phenylmethoxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174±0.06 g/cm3 |
|---|---|
| Boiling Point | 498.0±35.0 °C |
| Melting Point | 57-58 °C |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.39200 |
| Exact Mass | 348.13600 |
| PSA | 44.76000 |
| LogP | 4.63120 |
| InChIKey | SLYKXRFTRIYUJV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| HS Code | 2918990090 |
|---|
|
~87%
Methyl 3,4-bis(... CAS#:54544-05-7 |
| Literature: PROTEOTECH, INC. Patent: WO2005/113489 A1, 2005 ; Location in patent: Page/Page column 90 ; |
|
~83%
Methyl 3,4-bis(... CAS#:54544-05-7 |
| Literature: Percec, Virgil; Peterca, Mihai; Sienkowska, Monika J.; Ilies, Marc A.; Aqad, Emad; Smidrkal, Jan; Heiney, Paul A. Journal of the American Chemical Society, 2006 , vol. 128, # 10 p. 3324 - 3334 |
|
~%
Methyl 3,4-bis(... CAS#:54544-05-7 |
| Literature: Schmidt, Rolf; Carrigan, Joseph G.; DeWolf, Christine E. Canadian Journal of Chemistry, 2006 , vol. 84, # 10 p. 1411 - 1415 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,3,4-bis(phenylmethoxy)-,methyl ester |
| 3,4-dibenzyloxybenzoic acid methyl ester |
| methyl 3,4-dibenzyloxybenzoate |
| 3,4-Bis-benzyloxy-benzoesaeure-methylester |
| Methyl 3,4-bis(benzyloxy)benzoate |
| 3,4-bis-benzyloxybenzoic acid methyl ester |