Benzenamine,4-chloro-N-(2,7-dinitro-9H-fluoren-9-ylidene)- structure
|
Common Name | Benzenamine,4-chloro-N-(2,7-dinitro-9H-fluoren-9-ylidene)- | ||
|---|---|---|---|---|
| CAS Number | 5455-05-0 | Molecular Weight | 379.75300 | |
| Density | 1.52g/cm3 | Boiling Point | 567.3ºC at 760 mmHg | |
| Molecular Formula | C19H10ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.9ºC | |
| Name | N-(4-chlorophenyl)-2,7-dinitrofluoren-9-imine |
|---|
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 567.3ºC at 760 mmHg |
| Molecular Formula | C19H10ClN3O4 |
| Molecular Weight | 379.75300 |
| Flash Point | 296.9ºC |
| Exact Mass | 379.03600 |
| PSA | 104.00000 |
| LogP | 6.35230 |
| Index of Refraction | 1.725 |
| InChIKey | VBAKYNBPOBXNOG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(=Nc1ccc(Cl)cc1)c1cc([N+](=O)[O-])ccc1-2 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |