N-(4-methylphenyl)-2,7-dinitro-fluoren-9-imine structure
|
Common Name | N-(4-methylphenyl)-2,7-dinitro-fluoren-9-imine | ||
|---|---|---|---|---|
| CAS Number | 5455-06-1 | Molecular Weight | 359.33500 | |
| Density | 1.4g/cm3 | Boiling Point | 553.9ºC at 760 mmHg | |
| Molecular Formula | C20H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.8ºC | |
| Name | hydroxy-[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-methyl-phenylsilane |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 553.9ºC at 760 mmHg |
| Molecular Formula | C20H13N3O4 |
| Molecular Weight | 359.33500 |
| Flash Point | 288.8ºC |
| Exact Mass | 359.09100 |
| PSA | 104.00000 |
| LogP | 6.00730 |
| Index of Refraction | 1.701 |
| InChIKey | UBRSQNQFVKREFU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=C2c3cc([N+](=O)[O-])ccc3-c3ccc([N+](=O)[O-])cc32)cc1 |
| HS Code | 2921430090 |
|---|
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |