Benzenamine,N-(2,5-dinitro-9H-fluoren-9-ylidene)-4-methoxy-
Modify Date: 2025-08-26 14:51:52
Benzenamine,N-(2,5-dinitro-9H-fluoren-9-ylidene)-4-methoxy- structure
|
Common Name | Benzenamine,N-(2,5-dinitro-9H-fluoren-9-ylidene)-4-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 5455-07-2 | Molecular Weight | 375.33400 | |
| Density | 1.43g/cm3 | Boiling Point | 574.8ºC at 760 mmHg | |
| Molecular Formula | C20H13N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.4ºC | |
| Name | (Z)-N-(4-methoxyphenyl)-2,5-dinitro-9H-fluoren-9-imine |
|---|
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 574.8ºC at 760 mmHg |
| Molecular Formula | C20H13N3O5 |
| Molecular Weight | 375.33400 |
| Flash Point | 301.4ºC |
| Exact Mass | 375.08600 |
| PSA | 113.23000 |
| LogP | 5.70750 |
| Index of Refraction | 1.691 |
| InChIKey | CGJSGSMAQFBMNJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=C2c3cc([N+](=O)[O-])ccc3-c3c2cccc3[N+](=O)[O-])cc1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |