Benzenamine,4-methoxy-N-(2,4,7-trinitro-9H-fluoren-9-ylidene)- structure
|
Common Name | Benzenamine,4-methoxy-N-(2,4,7-trinitro-9H-fluoren-9-ylidene)- | ||
|---|---|---|---|---|
| CAS Number | 5455-08-3 | Molecular Weight | 420.33200 | |
| Density | 1.57g/cm3 | Boiling Point | 617ºC at 760mmHg | |
| Molecular Formula | C20H12N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327ºC | |
| Name | N-(4-methoxyphenyl)-2,4,7-trinitrofluoren-9-imine |
|---|
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 617ºC at 760mmHg |
| Molecular Formula | C20H12N4O7 |
| Molecular Weight | 420.33200 |
| Flash Point | 327ºC |
| Exact Mass | 420.07100 |
| PSA | 159.05000 |
| LogP | 6.13890 |
| Index of Refraction | 1.723 |
| InChIKey | IZXVWWGECVZLSH-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=C2c3cc([N+](=O)[O-])ccc3-c3c2cc([N+](=O)[O-])cc3[N+](=O)[O-])cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |