5,6-Dibromo-2,3-norbornanedicarboxylic anhydride
Modify Date: 2025-08-28 17:51:33
5,6-Dibromo-2,3-norbornanedicarboxylic anhydride structure
|
Common Name | 5,6-Dibromo-2,3-norbornanedicarboxylic anhydride | ||
|---|---|---|---|---|
| CAS Number | 5455-81-2 | Molecular Weight | 323.96600 | |
| Density | 2.128g/cm3 | Boiling Point | 430.1ºC at 760 mmHg | |
| Molecular Formula | C9H8Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.9ºC | |
| Name | 5,6-Dibromohexahydro-4,7-methanoisobenzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.128g/cm3 |
|---|---|
| Boiling Point | 430.1ºC at 760 mmHg |
| Molecular Formula | C9H8Br2O3 |
| Molecular Weight | 323.96600 |
| Flash Point | 213.9ºC |
| Exact Mass | 321.88400 |
| PSA | 43.37000 |
| LogP | 1.47890 |
| Index of Refraction | 1.643 |
| InChIKey | HHFFMUZIOYHTFC-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C2C3CC(C(Br)C3Br)C12 |
| HS Code | 2932999099 |
|---|
|
~%
5,6-Dibromo-2,3... CAS#:5455-81-2 |
| Literature: Journal of the American Chemical Society, , vol. 81, p. 1655,1659 |
|
~%
5,6-Dibromo-2,3... CAS#:5455-81-2 |
| Literature: Journal of the American Chemical Society, , vol. 81, p. 1655,1659 |
![Bicyclo[2.2.1]heptane-2,3-dicarboxylicacid, 5,6-dibromo- structure](https://image.chemsrc.com/caspic/411/6319-07-9.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,6-Dibromo-2,3-norbornanedicarboxylic anhydride |
| 5,6-dibromohexahydro-4,7-methano-2-benzofuran-1,3-dione |
| 4,7-methanoisobenzofuran-1,3-dione,5,6-dibromohexahydro |
| 2,3-Norbornanedicarboxylic anhydride,5,6-dibromo |