2-cyclohexyloxy-4-methyl-2-oxo-1,3-diaza-2$l^C10H17N2O3P-phosphacyclohex-4-en-6-one structure
|
Common Name | 2-cyclohexyloxy-4-methyl-2-oxo-1,3-diaza-2$l^C10H17N2O3P-phosphacyclohex-4-en-6-one | ||
|---|---|---|---|---|
| CAS Number | 54559-69-2 | Molecular Weight | 244.22700 | |
| Density | 1.25g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H17N2O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-cyclohexyloxy-6-methyl-2-oxo-1,3-dihydro-1,3,2λ5-diazaphosphinin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Molecular Formula | C10H17N2O3P |
| Molecular Weight | 244.22700 |
| Exact Mass | 244.09800 |
| PSA | 77.24000 |
| LogP | 2.72460 |
| Index of Refraction | 1.525 |
| InChIKey | RFUTXTLGCGMOPA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NP(=O)(OC2CCCCC2)N1 |
|
~%
2-cyclohexyloxy... CAS#:54559-69-2 |
| Literature: Preobrazhenskaya,M.N. et al. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1974 , vol. 10, p. 1261 Khimiya Geterotsiklicheskikh Soedinenii, 1974 , vol. 10, p. 1433 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-cyclohexyloxy-6-methyl-2-oxo-1,3-dihydro-1,3,2 |